C14H7ClF6N2O2 — CID 153312523
2-chloro-1-[2-(trifluoromethyl)-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3-pyridinyl]ethanone (PubChem CID 153312523) has the molecular formula C14H7ClF6N2O2 and a molecular weight of 384.66 g/mol. Its IUPAC name is 2-chloro-1-[2-(trifluoromethyl)-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3-pyridinyl]ethanone.
| Compound Name | 2-chloro-1-[2-(trifluoromethyl)-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 153312523 |
| Molecular Formula | C14H7ClF6N2O2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-chloro-1-[2-(trifluoromethyl)-6-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3-pyridinyl]ethanone |
| SMILES | O=C(CCl)c1ccc(Oc2ccc(C(F)(F)F)nc2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H7ClF6N2O2/c15-5-9(24)8-2-4-11(23-12(8)14(19,20)21)25-7-1-3-10(22-6-7)13(16,17)18/h1-4,6H,5H2 |
| InChIKey | LDMHFKDPSWXNCV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|