About N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride
N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride (PubChem CID 153312546) has the molecular formula C20H18Cl2N4O
and a molecular weight of 401.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride |
| PubChem CID | 153312546 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H17ClN4O.ClH/c21-13-7-5-12(6-8-13)18-19-15(14-3-1-2-4-16(14)24-19)11-17(25-18)20(26)23-10-9-22;/h1-8,11,24H,9-10,22H2,(H,23,26);1H |
| InChIKey | MEKHDJCOYHRLPA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride (CID 153312546) is N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride is Cl.NCCNC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccc(Cl)cc2)n1.
What is the InChIKey of N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride?
The InChIKey is MEKHDJCOYHRLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4O.ClH/c21-13-7-5-12(6-8-13)18-19-15(14-3-1-2-4-16(14)24-19)11-17(25-18)20(26)23-10-9-22;/h1-8,11,24H,9-10,22H2,(H,23,26);1H.
What are the key properties of N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride?
N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride has a molecular weight of 401.30 g/mol, XLogP of 4.15, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide;hydrochloride is sourced from PubChem (CID 153312546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).