About 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole
2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole (PubChem CID 153313168) has the molecular formula C20H16N4O
and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole |
| PubChem CID | 153313168 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole |
| SMILES | CC1=NN=C2C=Cc3c(cc(-c4ncco4)n3Cc3ccccc3)C12 |
| InChI | InChI=1S/C20H16N4O/c1-13-19-15-11-18(20-21-9-10-25-20)24(12-14-5-3-2-4-6-14)17(15)8-7-16(19)23-22-13/h2-11,19H,12H2,1H3 |
| InChIKey | XNUSRWXOUBNSGL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole?
The IUPAC name of 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole (CID 153313168) is 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole.
What is the SMILES notation for 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole?
The canonical SMILES for 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole is CC1=NN=C2C=Cc3c(cc(-c4ncco4)n3Cc3ccccc3)C12.
What is the InChIKey of 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole?
The InChIKey is XNUSRWXOUBNSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O/c1-13-19-15-11-18(20-21-9-10-25-20)24(12-14-5-3-2-4-6-14)17(15)8-7-16(19)23-22-13/h2-11,19H,12H2,1H3.
What are the key properties of 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole?
2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole has a molecular weight of 328.38 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-benzyl-1-methyl-8bH-pyrrolo[3,2-e]indazol-7-yl)-1,3-oxazole is sourced from PubChem (CID 153313168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).