C19H18F6O5S2 — CID 153313530
2-ethyl-5-[2-(4-ethylsulfonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenesulfonic acid (PubChem CID 153313530) has the molecular formula C19H18F6O5S2 and a molecular weight of 504.47 g/mol. Its IUPAC name is 2-ethyl-5-[2-(4-ethylsulfonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenesulfonic acid.
| Compound Name | 2-ethyl-5-[2-(4-ethylsulfonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 153313530 |
| Molecular Formula | C19H18F6O5S2 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 2-ethyl-5-[2-(4-ethylsulfonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzenesulfonic acid |
| SMILES | CCc1ccc(C(c2ccc(S(=O)(=O)CC)cc2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C19H18F6O5S2/c1-3-12-5-6-14(11-16(12)32(28,29)30)17(18(20,21)22,19(23,24)25)13-7-9-15(10-8-13)31(26,27)4-2/h5-11H,3-4H2,1-2H3,(H,28,29,30) |
| InChIKey | KACPMTHGFWYDGO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|