C26H20F8N2O — CID 153313895
[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 153313895) has the molecular formula C26H20F8N2O and a molecular weight of 528.44 g/mol. Its IUPAC name is [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 153313895 |
| Molecular Formula | C26H20F8N2O |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)c2ccncc2)C[C@H]1c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20F8N2O/c1-23(18-6-8-20(27)9-7-18)15-36(22(37)17-10-12-35-13-11-17)14-21(23)16-2-4-19(5-3-16)24(28,25(29,30)31)26(32,33)34/h2-13,21H,14-15H2,1H3/t21-,23+/m0/s1 |
| InChIKey | KPQMLZZPHMHDEB-JTHBVZDNSA-N |
| XLogP | 6.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |