C23H24F6N2O2 — CID 153313897
(3S,4S)-N-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide (PubChem CID 153313897) has the molecular formula C23H24F6N2O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is (3S,4S)-N-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide.
| Compound Name | (3S,4S)-N-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 153313897 |
| Molecular Formula | C23H24F6N2O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (3S,4S)-N-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxamide |
| SMILES | CCNC(=O)N1C[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H24F6N2O2/c1-3-30-19(32)31-13-18(20(2,14-31)16-7-5-4-6-8-16)15-9-11-17(12-10-15)21(33,22(24,25)26)23(27,28)29/h4-12,18,33H,3,13-14H2,1-2H3,(H,30,32)/t18-,20+/m0/s1 |
| InChIKey | LBTVYXPRSQYQBA-AZUAARDMSA-N |
| XLogP | 5.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |