C28H28F8N2O2 — CID 153313905
1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 153313905) has the molecular formula C28H28F8N2O2 and a molecular weight of 576.53 g/mol. Its IUPAC name is 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 153313905 |
| Molecular Formula | C28H28F8N2O2 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 1-[4-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-methylpyrrolidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2C[C@@H](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)[C@@](C)(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C28H28F8N2O2/c1-17(39)37-13-11-19(12-14-37)24(40)38-15-23(25(2,16-38)20-7-9-22(29)10-8-20)18-3-5-21(6-4-18)26(30,27(31,32)33)28(34,35)36/h3-10,19,23H,11-16H2,1-2H3/t23-,25+/m0/s1 |
| InChIKey | NGSPJHSAVUXBGJ-UKILVPOCSA-N |
| XLogP | 6.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |