C27H24F7N3O2 — CID 153313928
(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-N-(pyridin-4-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 153313928) has the molecular formula C27H24F7N3O2 and a molecular weight of 555.49 g/mol. Its IUPAC name is (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-N-(pyridin-4-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-N-(pyridin-4-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 153313928 |
| Molecular Formula | C27H24F7N3O2 |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-N-(pyridin-4-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)NCc2ccncc2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H24F7N3O2/c1-24(19-6-8-21(28)9-7-19)16-37(23(38)36-14-17-10-12-35-13-11-17)15-22(24)18-2-4-20(5-3-18)25(39,26(29,30)31)27(32,33)34/h2-13,22,39H,14-16H2,1H3,(H,36,38)/t22-,24+/m0/s1 |
| InChIKey | SJVMHDPAJABFAS-LADGPHEKSA-N |
| XLogP | 5.80 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |