C21H36O5 — CID 153313983
1-[2-(2-hydroxyethoxy)ethoxy]-2-phenoxyundecan-2-ol (PubChem CID 153313983) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]-2-phenoxyundecan-2-ol.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-phenoxyundecan-2-ol |
|---|---|
| PubChem CID | 153313983 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-phenoxyundecan-2-ol |
| SMILES | CCCCCCCCCC(O)(COCCOCCO)Oc1ccccc1 |
| InChI | InChI=1S/C21H36O5/c1-2-3-4-5-6-7-11-14-21(23,19-25-18-17-24-16-15-22)26-20-12-9-8-10-13-20/h8-10,12-13,22-23H,2-7,11,14-19H2,1H3 |
| InChIKey | SHBRHEOSMQTGLI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|