C16H15F3N6O2S — CID 153314082
N-[4-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 153314082) has the molecular formula C16H15F3N6O2S and a molecular weight of 412.40 g/mol. Its IUPAC name is N-[4-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 153314082 |
| Molecular Formula | C16H15F3N6O2S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[4-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc(C(=O)N2CCC(Nc3ncc(C(F)(F)F)cn3)C2)cs1 |
| InChI | InChI=1S/C16H15F3N6O2S/c1-2-12(26)24-15-23-11(8-28-15)13(27)25-4-3-10(7-25)22-14-20-5-9(6-21-14)16(17,18)19/h2,5-6,8,10H,1,3-4,7H2,(H,20,21,22)(H,23,24,26) |
| InChIKey | RSMDTXWYRFXKRV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|