C16H14BN5O3 — CID 153314534
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-5-pyridin-3-yl-1,2,4-triazole-3-carboxamide (PubChem CID 153314534) has the molecular formula C16H14BN5O3 and a molecular weight of 335.13 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-5-pyridin-3-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-5-pyridin-3-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 153314534 |
| Molecular Formula | C16H14BN5O3 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-methyl-5-pyridin-3-yl-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1nc(-c2cccnc2)nc1C(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C16H14BN5O3/c1-22-15(20-14(21-22)10-3-2-6-18-8-10)16(23)19-12-5-4-11-9-25-17(24)13(11)7-12/h2-8,24H,9H2,1H3,(H,19,23) |
| InChIKey | OWNFYRUMIQJTSN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|