C10H23BClNO2 — CID 153315417
(1R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine;hydrochloride (PubChem CID 153315417) has the molecular formula C10H23BClNO2 and a molecular weight of 235.56 g/mol. Its IUPAC name is (1R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 153315417 |
| Molecular Formula | C10H23BClNO2 |
| Molecular Weight | 235.56 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | (1R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine;hydrochloride |
| SMILES | CC(C)[C@H](N)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C10H22BNO2.ClH/c1-7(2)8(12)11-13-9(3,4)10(5,6)14-11;/h7-8H,12H2,1-6H3;1H/t8-;/m0./s1 |
| InChIKey | DNNYZPSQUZNJOQ-QRPNPIFTSA-N |
| XLogP | 2.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|