About [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid
[(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid (PubChem CID 153315572) has the molecular formula C11H18O5S
and a molecular weight of 262.33 g/mol. Its IUPAC name is [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid.
Molecular Properties
| Compound Name | [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid |
| PubChem CID | 153315572 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid |
| SMILES | COC(=O)C(C)C1[C@H]2CC(CS(=O)(=O)O)C[C@@H]12 |
| InChI | InChI=1S/C11H18O5S/c1-6(11(12)16-2)10-8-3-7(4-9(8)10)5-17(13,14)15/h6-10H,3-5H2,1-2H3,(H,13,14,15)/t6?,7?,8-,9+,10? |
| InChIKey | PJMLCSPBNWUOBO-FTKOINSTSA-N |
| XLogP | 0.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid?
The IUPAC name of [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid (CID 153315572) is [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid.
What is the SMILES notation for [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid?
The canonical SMILES for [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid is COC(=O)C(C)C1[C@H]2CC(CS(=O)(=O)O)C[C@@H]12.
What is the InChIKey of [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid?
The InChIKey is PJMLCSPBNWUOBO-FTKOINSTSA-N. The full InChI is InChI=1S/C11H18O5S/c1-6(11(12)16-2)10-8-3-7(4-9(8)10)5-17(13,14)15/h6-10H,3-5H2,1-2H3,(H,13,14,15)/t6?,7?,8-,9+,10?.
What are the key properties of [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid?
[(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid has a molecular weight of 262.33 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-6-(1-methoxy-1-oxopropan-2-yl)-3-bicyclo[3.1.0]hexanyl]methanesulfonic acid is sourced from PubChem (CID 153315572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).