C56H67BN2 — CID 153315681
11-(1-adamantyl)-5,17-ditert-butyl-8,14-bis(3-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 153315681) has the molecular formula C56H67BN2 and a molecular weight of 778.98 g/mol. Its IUPAC name is 11-(1-adamantyl)-5,17-ditert-butyl-8,14-bis(3-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-(1-adamantyl)-5,17-ditert-butyl-8,14-bis(3-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153315681 |
| Molecular Formula | C56H67BN2 |
| Molecular Weight | 778.98 g/mol |
| Exact Mass | 778.54 |
| IUPAC Name | 11-(1-adamantyl)-5,17-ditert-butyl-8,14-bis(3-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1cccc(N2c3cc(C(C)(C)C)ccc3B3c4ccc(C(C)(C)C)cc4N(c4cccc(C(C)(C)C)c4)c4cc(C56CC7CC(CC(C7)C5)C6)cc2c43)c1 |
| InChI | InChI=1S/C56H67BN2/c1-52(2,3)38-15-13-17-43(26-38)58-47-28-40(54(7,8)9)19-21-45(47)57-46-22-20-41(55(10,11)12)29-48(46)59(44-18-14-16-39(27-44)53(4,5)6)50-31-42(30-49(58)51(50)57)56-32-35-23-36(33-56)25-37(24-35)34-56/h13-22,26-31,35-37H,23-25,32-34H2,1-12H3 |
| InChIKey | HHXRZDOEYSQDFH-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.98 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|