C44H30N4O2Zn — CID 15331603
zinc (2R,3S)-5,10,15,20-tetraphenyl-2,3-dihydroporphyrin-22,24-diide-2,3-diol (PubChem CID 15331603) has the molecular formula C44H30N4O2Zn and a molecular weight of 712.14 g/mol. Its IUPAC name is zinc (2R,3S)-5,10,15,20-tetraphenyl-2,3-dihydroporphyrin-22,24-diide-2,3-diol.
| Compound Name | zinc (2R,3S)-5,10,15,20-tetraphenyl-2,3-dihydroporphyrin-22,24-diide-2,3-diol |
|---|---|
| PubChem CID | 15331603 |
| Molecular Formula | C44H30N4O2Zn |
| Molecular Weight | 712.14 g/mol |
| Exact Mass | 710.17 |
| IUPAC Name | zinc (2R,3S)-5,10,15,20-tetraphenyl-2,3-dihydroporphyrin-22,24-diide-2,3-diol |
| SMILES | O[C@@H]1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([n-]4)c2-c2ccccc2)C=C3)[C@@H]1O.[Zn+2] |
| InChI | InChI=1S/C44H30N4O2.Zn/c49-43-41-39(29-17-9-3-10-18-29)35-25-23-33(46-35)37(27-13-5-1-6-14-27)31-21-22-32(45-31)38(28-15-7-2-8-16-28)34-24-26-36(47-34)40(42(48-41)44(43)50)30-19-11-4-12-20-30;/h1-26,43-44,49-50H;/q-2;+2/b37-31-,37-33-,38-32-,38-34-,39-35-,40-36-,41-39-,42-40-;/t43-,44+; |
| InChIKey | SCHYCWZVFFOONR-BFSAKQSASA-N |
| XLogP | 9.18 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.14 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|