C39H59NO4Si — CID 153316534
methyl 2-[[(5Z,14Z,19S)-19-[tert-butyl(diphenyl)silyl]oxyicosa-5,14-dienoyl]amino]acetate (PubChem CID 153316534) has the molecular formula C39H59NO4Si and a molecular weight of 633.99 g/mol. Its IUPAC name is methyl 2-[[(5Z,14Z,19S)-19-[tert-butyl(diphenyl)silyl]oxyicosa-5,14-dienoyl]amino]acetate.
| Compound Name | methyl 2-[[(5Z,14Z,19S)-19-[tert-butyl(diphenyl)silyl]oxyicosa-5,14-dienoyl]amino]acetate |
|---|---|
| PubChem CID | 153316534 |
| Molecular Formula | C39H59NO4Si |
| Molecular Weight | 633.99 g/mol |
| Exact Mass | 633.42 |
| IUPAC Name | methyl 2-[[(5Z,14Z,19S)-19-[tert-butyl(diphenyl)silyl]oxyicosa-5,14-dienoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CCC/C=C\CCCCCCC/C=C\CCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H59NO4Si/c1-34(44-45(39(2,3)4,35-28-22-19-23-29-35)36-30-24-20-25-31-36)27-21-17-15-13-11-9-7-6-8-10-12-14-16-18-26-32-37(41)40-33-38(42)43-5/h13-16,19-20,22-25,28-31,34H,6-12,17-18,21,26-27,32-33H2,1-5H3,(H,40,41)/b15-13-,16-14-/t34-/m0/s1 |
| InChIKey | MZZCAYXLQPCVLY-WACVVIDXSA-N |
| XLogP | 8.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.99 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|