C22H38NNaO4 — CID 153316563
sodium 2-[[(5Z,14Z)-18-hydroxyicosa-5,14-dienoyl]amino]acetate (PubChem CID 153316563) has the molecular formula C22H38NNaO4 and a molecular weight of 403.54 g/mol. Its IUPAC name is sodium 2-[[(5Z,14Z)-18-hydroxyicosa-5,14-dienoyl]amino]acetate.
| Compound Name | sodium 2-[[(5Z,14Z)-18-hydroxyicosa-5,14-dienoyl]amino]acetate |
|---|---|
| PubChem CID | 153316563 |
| Molecular Formula | C22H38NNaO4 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | sodium 2-[[(5Z,14Z)-18-hydroxyicosa-5,14-dienoyl]amino]acetate |
| SMILES | CCC(O)CC/C=C\CCCCCCC/C=C\CCCC(=O)NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H39NO4.Na/c1-2-20(24)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-21(25)23-19-22(26)27;/h10-13,20,24H,2-9,14-19H2,1H3,(H,23,25)(H,26,27);/q;+1/p-1/b12-10-,13-11-; |
| InChIKey | BREJJPKGMBCQIY-KTUALKGKSA-M |
| XLogP | 0.42 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|