About [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate
[3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate (PubChem CID 153317884) has the molecular formula C15H24O7
and a molecular weight of 316.35 g/mol. Its IUPAC name is [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate.
Molecular Properties
| Compound Name | [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate |
| PubChem CID | 153317884 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate |
| SMILES | CC(=O)OC(C)C(=O)OCCC(=O)OC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H24O7/c1-9(13(18)15(4,5)6)22-12(17)7-8-20-14(19)10(2)21-11(3)16/h9-10H,7-8H2,1-6H3 |
| InChIKey | PJUZEENZXYNYFA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate?
The IUPAC name of [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate (CID 153317884) is [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate.
What is the SMILES notation for [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate?
The canonical SMILES for [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate is CC(=O)OC(C)C(=O)OCCC(=O)OC(C)C(=O)C(C)(C)C.
What is the InChIKey of [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate?
The InChIKey is PJUZEENZXYNYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O7/c1-9(13(18)15(4,5)6)22-12(17)7-8-20-14(19)10(2)21-11(3)16/h9-10H,7-8H2,1-6H3.
What are the key properties of [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate?
[3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate has a molecular weight of 316.35 g/mol, XLogP of 1.42, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4,4-dimethyl-3-oxopentan-2-yl)oxy-3-oxopropyl] 2-acetyloxypropanoate is sourced from PubChem (CID 153317884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).