About N-benzyl-1-(1,3-dioxolan-4-yl)methanamine
N-benzyl-1-(1,3-dioxolan-4-yl)methanamine (PubChem CID 15331863) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-benzyl-1-(1,3-dioxolan-4-yl)methanamine.
Molecular Properties
| Compound Name | N-benzyl-1-(1,3-dioxolan-4-yl)methanamine |
| PubChem CID | 15331863 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-benzyl-1-(1,3-dioxolan-4-yl)methanamine |
| SMILES | c1ccc(CNCC2COCO2)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)6-12-7-11-8-13-9-14-11/h1-5,11-12H,6-9H2 |
| InChIKey | VCOXMSSPLOOSBR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1-(1,3-dioxolan-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(1,3-dioxolan-4-yl)methanamine?
The IUPAC name of N-benzyl-1-(1,3-dioxolan-4-yl)methanamine (CID 15331863) is N-benzyl-1-(1,3-dioxolan-4-yl)methanamine.
What is the SMILES notation for N-benzyl-1-(1,3-dioxolan-4-yl)methanamine?
The canonical SMILES for N-benzyl-1-(1,3-dioxolan-4-yl)methanamine is c1ccc(CNCC2COCO2)cc1.
What is the InChIKey of N-benzyl-1-(1,3-dioxolan-4-yl)methanamine?
The InChIKey is VCOXMSSPLOOSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)6-12-7-11-8-13-9-14-11/h1-5,11-12H,6-9H2.
What are the key properties of N-benzyl-1-(1,3-dioxolan-4-yl)methanamine?
N-benzyl-1-(1,3-dioxolan-4-yl)methanamine has a molecular weight of 193.25 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(1,3-dioxolan-4-yl)methanamine is sourced from PubChem (CID 15331863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).