C45H28N4Si — CID 153318851
9-[4-(4,5-diisocyano-2-triphenylsilylphenyl)phenyl]carbazole-3-carbonitrile (PubChem CID 153318851) has the molecular formula C45H28N4Si and a molecular weight of 652.83 g/mol. Its IUPAC name is 9-[4-(4,5-diisocyano-2-triphenylsilylphenyl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[4-(4,5-diisocyano-2-triphenylsilylphenyl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 153318851 |
| Molecular Formula | C45H28N4Si |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 9-[4-(4,5-diisocyano-2-triphenylsilylphenyl)phenyl]carbazole-3-carbonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc(-n3c4ccccc4c4cc(C#N)ccc43)cc2)c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C45H28N4Si/c1-47-41-29-39(33-23-25-34(26-24-33)49-43-21-13-12-20-38(43)40-28-32(31-46)22-27-44(40)49)45(30-42(41)48-2)50(35-14-6-3-7-15-35,36-16-8-4-9-17-36)37-18-10-5-11-19-37/h3-30H |
| InChIKey | KMWUENRQBDBLCV-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|