C21H23N4O9P — CID 153318980
[(2R,5R)-5-[3-[[4-(2-aminophenyl)-2-pyridinyl]methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 153318980) has the molecular formula C21H23N4O9P and a molecular weight of 506.41 g/mol. Its IUPAC name is [(2R,5R)-5-[3-[[4-(2-aminophenyl)-2-pyridinyl]methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-5-[3-[[4-(2-aminophenyl)-2-pyridinyl]methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 153318980 |
| Molecular Formula | C21H23N4O9P |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [(2R,5R)-5-[3-[[4-(2-aminophenyl)-2-pyridinyl]methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1ccccc1-c1ccnc(Cn2c(=O)ccn([C@@H]3O[C@H](COP(=O)(O)O)C(O)C3O)c2=O)c1 |
| InChI | InChI=1S/C21H23N4O9P/c22-15-4-2-1-3-14(15)12-5-7-23-13(9-12)10-25-17(26)6-8-24(21(25)29)20-19(28)18(27)16(34-20)11-33-35(30,31)32/h1-9,16,18-20,27-28H,10-11,22H2,(H2,30,31,32)/t16-,18?,19?,20-/m1/s1 |
| InChIKey | IJNNUIYVIWGDSY-SGZDXZSOSA-N |
| XLogP | -0.57 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|