C27H27FN4O4S — CID 153319414
5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-3-[1-[2-(sulfinomethylamino)ethyl]indol-4-yl]-1H-pyrrole-2-carboxylic acid (PubChem CID 153319414) has the molecular formula C27H27FN4O4S and a molecular weight of 522.60 g/mol. Its IUPAC name is 5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-3-[1-[2-(sulfinomethylamino)ethyl]indol-4-yl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-3-[1-[2-(sulfinomethylamino)ethyl]indol-4-yl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 153319414 |
| Molecular Formula | C27H27FN4O4S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-3-[1-[2-(sulfinomethylamino)ethyl]indol-4-yl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CC(C)c1c(-c2cc(F)cc3[nH]ccc23)[nH]c(C(=O)O)c1-c1cccc2c1ccn2CCNCS(=O)O |
| InChI | InChI=1S/C27H27FN4O4S/c1-15(2)23-24(19-4-3-5-22-18(19)7-10-32(22)11-9-29-14-37(35)36)26(27(33)34)31-25(23)20-12-16(28)13-21-17(20)6-8-30-21/h3-8,10,12-13,15,29-31H,9,11,14H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | JGDQPFQBKDCYSI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|