C30H50N2O2 — CID 153320154
(4S)-4-[(3S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-piperidin-1-ylpent-2-enamide (PubChem CID 153320154) has the molecular formula C30H50N2O2 and a molecular weight of 470.74 g/mol. Its IUPAC name is (4S)-4-[(3S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-piperidin-1-ylpent-2-enamide.
| Compound Name | (4S)-4-[(3S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-piperidin-1-ylpent-2-enamide |
|---|---|
| PubChem CID | 153320154 |
| Molecular Formula | C30H50N2O2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | (4S)-4-[(3S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-piperidin-1-ylpent-2-enamide |
| SMILES | CC(=C(C(N)=O)N1CCCCC1)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50N2O2/c1-19(20(2)27(28(31)34)32-16-6-5-7-17-32)24-10-11-25-23-9-8-21-18-22(33)12-14-29(21,3)26(23)13-15-30(24,25)4/h19,21-26,33H,5-18H2,1-4H3,(H2,31,34)/t19-,21?,22+,23+,24-,25+,26+,29+,30-/m1/s1 |
| InChIKey | GCNCEROFVJBCFY-WYRTZZDSSA-N |
| XLogP | 5.89 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|