About 10-bromodec-7-enyl acetate
10-bromodec-7-enyl acetate (PubChem CID 153320364) has the molecular formula C12H21BrO2
and a molecular weight of 277.20 g/mol. Its IUPAC name is 10-bromodec-7-enyl acetate.
Molecular Properties
| Compound Name | 10-bromodec-7-enyl acetate |
| PubChem CID | 153320364 |
| Molecular Formula | C12H21BrO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 10-bromodec-7-enyl acetate |
| SMILES | CC(=O)OCCCCCCC=CCCBr |
| InChI | InChI=1S/C12H21BrO2/c1-12(14)15-11-9-7-5-3-2-4-6-8-10-13/h4,6H,2-3,5,7-11H2,1H3 |
| InChIKey | XCJWOISSEZZUBZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-bromodec-7-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromodec-7-enyl acetate?
The IUPAC name of 10-bromodec-7-enyl acetate (CID 153320364) is 10-bromodec-7-enyl acetate.
What is the SMILES notation for 10-bromodec-7-enyl acetate?
The canonical SMILES for 10-bromodec-7-enyl acetate is CC(=O)OCCCCCCC=CCCBr.
What is the InChIKey of 10-bromodec-7-enyl acetate?
The InChIKey is XCJWOISSEZZUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BrO2/c1-12(14)15-11-9-7-5-3-2-4-6-8-10-13/h4,6H,2-3,5,7-11H2,1H3.
What are the key properties of 10-bromodec-7-enyl acetate?
10-bromodec-7-enyl acetate has a molecular weight of 277.20 g/mol, XLogP of 3.84, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromodec-7-enyl acetate is sourced from PubChem (CID 153320364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).