About 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole
5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole (PubChem CID 153320918) has the molecular formula C18H16FNO3
and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole |
| PubChem CID | 153320918 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2noc(CF)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H16FNO3/c1-21-14-7-3-12(4-8-14)17-16(11-19)23-20-18(17)13-5-9-15(22-2)10-6-13/h3-10H,11H2,1-2H3 |
| InChIKey | ZSNBFKKVERDHJL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole?
The IUPAC name of 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole (CID 153320918) is 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole.
What is the SMILES notation for 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole?
The canonical SMILES for 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole is COc1ccc(-c2noc(CF)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole?
The InChIKey is ZSNBFKKVERDHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO3/c1-21-14-7-3-12(4-8-14)17-16(11-19)23-20-18(17)13-5-9-15(22-2)10-6-13/h3-10H,11H2,1-2H3.
What are the key properties of 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole?
5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole has a molecular weight of 313.33 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole is sourced from PubChem (CID 153320918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).