C27H18F4NNaO6S — CID 153320929
sodium 4-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153320929) has the molecular formula C27H18F4NNaO6S and a molecular weight of 583.49 g/mol. Its IUPAC name is sodium 4-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | sodium 4-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153320929 |
| Molecular Formula | C27H18F4NNaO6S |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | sodium 4-[4-[(E)-2-[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]ethenyl]benzoyl]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | Cc1c(/C=C/c2ccc(C(=O)c3c(F)c(F)c(S(=O)(=O)[O-])c(F)c3F)cc2)c(=O)oc2cc(N(C)C)ccc12.[Na+] |
| InChI | InChI=1S/C27H19F4NO6S.Na/c1-13-17-11-9-16(32(2)3)12-19(17)38-27(34)18(13)10-6-14-4-7-15(8-5-14)25(33)20-21(28)23(30)26(39(35,36)37)24(31)22(20)29;/h4-12H,1-3H3,(H,35,36,37);/q;+1/p-1/b10-6+; |
| InChIKey | NSXWFAREKIYDGX-AAGWESIMSA-M |
| XLogP | 2.03 |
| TPSA | 107.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|