C33H47ClFN5O8 — CID 153321158
N-[1-[3-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]-9-[(4-fluorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]prop-2-enamide (PubChem CID 153321158) has the molecular formula C33H47ClFN5O8 and a molecular weight of 696.22 g/mol. Its IUPAC name is N-[1-[3-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]-9-[(4-fluorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]prop-2-enamide.
| Compound Name | N-[1-[3-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]-9-[(4-fluorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]prop-2-enamide |
|---|---|
| PubChem CID | 153321158 |
| Molecular Formula | C33H47ClFN5O8 |
| Molecular Weight | 696.22 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | N-[1-[3-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]-9-[(4-fluorophenyl)methyl]-3-methyl-2,6-dioxopurin-8-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(=O)n(CCCOCCOCCOCCOCCOCCCCCCCl)c(=O)n(C)c2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C33H47ClFN5O8/c1-3-28(41)36-32-37-29-30(40(32)25-26-9-11-27(35)12-10-26)38(2)33(43)39(31(29)42)14-8-16-45-18-20-47-22-24-48-23-21-46-19-17-44-15-7-5-4-6-13-34/h3,9-12H,1,4-8,13-25H2,2H3,(H,36,37,41) |
| InChIKey | PSSSMMLIATWJEU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|