C23H45F2N3O5S — CID 153321545
[(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium (PubChem CID 153321545) has the molecular formula C23H45F2N3O5S and a molecular weight of 513.69 g/mol. Its IUPAC name is [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium.
| Compound Name | [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
|---|---|
| PubChem CID | 153321545 |
| Molecular Formula | C23H45F2N3O5S |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C1N2C[C@@H](CC[C@H]2C(F)F)N1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C7H10F2N2O5S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-6(9)5-2-1-4-3-10(5)7(12)11(4)16-17(13,14)15/h5-16H2,1-4H3;4-6H,1-3H2,(H,13,14,15)/q+1;/p-1/t;4-,5+/m.1/s1 |
| InChIKey | TXQCMVHCLUXXME-SJGICDGZSA-M |
| XLogP | 4.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|