C16H17N3O2S — CID 153321701
tert-butyl N-prop-2-ynyl-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)carbamate (PubChem CID 153321701) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is tert-butyl N-prop-2-ynyl-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)carbamate.
| Compound Name | tert-butyl N-prop-2-ynyl-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 153321701 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | tert-butyl N-prop-2-ynyl-N-(2-pyridin-3-yl-1,3-thiazol-5-yl)carbamate |
| SMILES | C#CCN(C(=O)OC(C)(C)C)c1cnc(-c2cccnc2)s1 |
| InChI | InChI=1S/C16H17N3O2S/c1-5-9-19(15(20)21-16(2,3)4)13-11-18-14(22-13)12-7-6-8-17-10-12/h1,6-8,10-11H,9H2,2-4H3 |
| InChIKey | VAYSJMLNWHPWNH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|