C7H12F3NO2 — CID 153321758
methyl (5R)-5-amino-6,6,6-trifluorohexanoate (PubChem CID 153321758) has the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. Its IUPAC name is methyl (5R)-5-amino-6,6,6-trifluorohexanoate.
| Compound Name | methyl (5R)-5-amino-6,6,6-trifluorohexanoate |
|---|---|
| PubChem CID | 153321758 |
| Molecular Formula | C7H12F3NO2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl (5R)-5-amino-6,6,6-trifluorohexanoate |
| SMILES | COC(=O)CCC[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2/c1-13-6(12)4-2-3-5(11)7(8,9)10/h5H,2-4,11H2,1H3/t5-/m1/s1 |
| InChIKey | JULLMMMBODTARU-RXMQYKEDSA-N |
| XLogP | 1.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |