About CID 153322105
CID 153322105 (PubChem CID 153322105) has the molecular formula C60H84N3O3Si3
and a molecular weight of 979.61 g/mol.
Molecular Properties
| Compound Name | CID 153322105 |
| PubChem CID | 153322105 |
| Molecular Formula | C60H84N3O3Si3 |
| Molecular Weight | 979.61 g/mol |
| Exact Mass | 978.58 |
| IUPAC Name | — |
| SMILES | C=CCCCC(CC=C)[Si](CC(C)c1ccccc1)Cn1c(=O)n(C[Si](CC(C)c2ccccc2)C(CC=C)CCCC=C)c(=O)n(C[Si](CC(C)c2ccccc2)C(CC=C)CCCC=C)c1=O |
| InChI | InChI=1S/C60H84N3O3Si3/c1-10-16-22-40-55(31-13-4)67(43-49(7)52-34-25-19-26-35-52)46-61-58(64)62(47-68(56(32-14-5)41-23-17-11-2)44-50(8)53-36-27-20-28-37-53)60(66)63(59(61)65)48-69(57(33-15-6)42-24-18-12-3)45-51(9)54-38-29-21-30-39-54/h10-15,19-21,25-30,34-39,49-51,55-57H,1-6,16-18,22-24,31-33,40-48H2,7-9H3 |
| InChIKey | YIZYRSGMHBBMJH-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 979.61 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 153322105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153322105?
The IUPAC name of CID 153322105 (CID 153322105) is not available.
What is the SMILES notation for CID 153322105?
The canonical SMILES for CID 153322105 is C=CCCCC(CC=C)[Si](CC(C)c1ccccc1)Cn1c(=O)n(C[Si](CC(C)c2ccccc2)C(CC=C)CCCC=C)c(=O)n(C[Si](CC(C)c2ccccc2)C(CC=C)CCCC=C)c1=O.
What is the InChIKey of CID 153322105?
The InChIKey is YIZYRSGMHBBMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H84N3O3Si3/c1-10-16-22-40-55(31-13-4)67(43-49(7)52-34-25-19-26-35-52)46-61-58(64)62(47-68(56(32-14-5)41-23-17-11-2)44-50(8)53-36-27-20-28-37-53)60(66)63(59(61)65)48-69(57(33-15-6)42-24-18-12-3)45-51(9)54-38-29-21-30-39-54/h10-15,19-21,25-30,34-39,49-51,55-57H,1-6,16-18,22-24,31-33,40-48H2,7-9H3.
What are the key properties of CID 153322105?
CID 153322105 has a molecular weight of 979.61 g/mol, XLogP of 14.59, 36 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153322105 is sourced from PubChem (CID 153322105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).