C10H4F12O — CID 153322569
5,6-difluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 153322569) has the molecular formula C10H4F12O and a molecular weight of 368.12 g/mol. Its IUPAC name is 5,6-difluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-difluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 153322569 |
| Molecular Formula | C10H4F12O |
| Molecular Weight | 368.12 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 5,6-difluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1(F)C2C=CC(O2)C1(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F12O/c11-5(7(13,9(17,18)19)10(20,21)22)3-1-2-4(23-3)6(5,12)8(14,15)16/h1-4H |
| InChIKey | YCQTYTDIOIDPIQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.12 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|