C27H34N2O4 — CID 153322619
3-[2-(3-amino-2-methylphenyl)-1,3-bis(oxiran-2-yl)propan-2-yl]-2-methyl-5,6-bis(oxiran-2-ylmethyl)aniline (PubChem CID 153322619) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-[2-(3-amino-2-methylphenyl)-1,3-bis(oxiran-2-yl)propan-2-yl]-2-methyl-5,6-bis(oxiran-2-ylmethyl)aniline.
| Compound Name | 3-[2-(3-amino-2-methylphenyl)-1,3-bis(oxiran-2-yl)propan-2-yl]-2-methyl-5,6-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 153322619 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 3-[2-(3-amino-2-methylphenyl)-1,3-bis(oxiran-2-yl)propan-2-yl]-2-methyl-5,6-bis(oxiran-2-ylmethyl)aniline |
| SMILES | Cc1c(N)cccc1C(CC1CO1)(CC1CO1)c1cc(CC2CO2)c(CC2CO2)c(N)c1C |
| InChI | InChI=1S/C27H34N2O4/c1-15-23(4-3-5-25(15)28)27(9-20-13-32-20,10-21-14-33-21)24-7-17(6-18-11-30-18)22(8-19-12-31-19)26(29)16(24)2/h3-5,7,18-21H,6,8-14,28-29H2,1-2H3 |
| InChIKey | RDSUYFLWVVLCET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|