C23H27N7O3 — CID 153322710
N-hydroxy-2-[2-[2-[[[2-(4-methoxyphenyl)cyclopropyl]amino]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]pyrimidin-5-yl]acetamide (PubChem CID 153322710) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is N-hydroxy-2-[2-[2-[[[2-(4-methoxyphenyl)cyclopropyl]amino]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]pyrimidin-5-yl]acetamide.
| Compound Name | N-hydroxy-2-[2-[2-[[[2-(4-methoxyphenyl)cyclopropyl]amino]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 153322710 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-hydroxy-2-[2-[2-[[[2-(4-methoxyphenyl)cyclopropyl]amino]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]pyrimidin-5-yl]acetamide |
| SMILES | COc1ccc(C2CC2NCc2cn3c(n2)CN(c2ncc(CC(=O)NO)cn2)CC3)cc1 |
| InChI | InChI=1S/C23H27N7O3/c1-33-18-4-2-16(3-5-18)19-9-20(19)24-12-17-13-29-6-7-30(14-21(29)27-17)23-25-10-15(11-26-23)8-22(31)28-32/h2-5,10-11,13,19-20,24,32H,6-9,12,14H2,1H3,(H,28,31) |
| InChIKey | XSUZTCUUAJXYDZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|