About 1-chloroethanol;manganese
1-chloroethanol;manganese (PubChem CID 153322750) has the molecular formula C2H4ClMnO-
and a molecular weight of 134.44 g/mol. Its IUPAC name is 1-chloroethanol;manganese.
Molecular Properties
| Compound Name | 1-chloroethanol;manganese |
| PubChem CID | 153322750 |
| Molecular Formula | C2H4ClMnO- |
| Molecular Weight | 134.44 g/mol |
| Exact Mass | 133.93 |
| IUPAC Name | 1-chloroethanol;manganese |
| SMILES | C[C-](O)Cl.[Mn] |
| InChI | InChI=1S/C2H4ClO.Mn/c1-2(3)4;/h4H,1H3;/q-1; |
| InChIKey | LVHJCNOAZAOASL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethanol;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethanol;manganese?
The IUPAC name of 1-chloroethanol;manganese (CID 153322750) is 1-chloroethanol;manganese.
What is the SMILES notation for 1-chloroethanol;manganese?
The canonical SMILES for 1-chloroethanol;manganese is C[C-](O)Cl.[Mn].
What is the InChIKey of 1-chloroethanol;manganese?
The InChIKey is LVHJCNOAZAOASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClO.Mn/c1-2(3)4;/h4H,1H3;/q-1;.
What are the key properties of 1-chloroethanol;manganese?
1-chloroethanol;manganese has a molecular weight of 134.44 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethanol;manganese is sourced from PubChem (CID 153322750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).