About 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene
2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene (PubChem CID 153323508) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene.
Molecular Properties
| Compound Name | 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene |
| PubChem CID | 153323508 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene |
| SMILES | C1=C2CC=C1NCCCCCCCCCCCC2 |
| InChI | InChI=1S/C17H29N/c1-2-4-6-8-10-14-18-17-13-12-16(15-17)11-9-7-5-3-1/h13,15,18H,1-12,14H2 |
| InChIKey | WRBSLNRCTWXDAB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene?
The IUPAC name of 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene (CID 153323508) is 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene.
What is the SMILES notation for 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene?
The canonical SMILES for 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene is C1=C2CC=C1NCCCCCCCCCCCC2.
What is the InChIKey of 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene?
The InChIKey is WRBSLNRCTWXDAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-2-4-6-8-10-14-18-17-13-12-16(15-17)11-9-7-5-3-1/h13,15,18H,1-12,14H2.
What are the key properties of 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene?
2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene has a molecular weight of 247.43 g/mol, XLogP of 5.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[13.2.1]octadeca-1(17),15(18)-diene is sourced from PubChem (CID 153323508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).