About tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane
tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane (PubChem CID 153323676) has the molecular formula C18H16F6OSi
and a molecular weight of 390.40 g/mol. Its IUPAC name is tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane.
Molecular Properties
| Compound Name | tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane |
| PubChem CID | 153323676 |
| Molecular Formula | C18H16F6OSi |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane |
| SMILES | O[Si](C1=CC=CC(F)(F)C1)(C1=CC=CC(F)(F)C1)C1=CC=CC(F)(F)C1 |
| InChI | InChI=1S/C18H16F6OSi/c19-16(20)7-1-4-13(10-16)26(25,14-5-2-8-17(21,22)11-14)15-6-3-9-18(23,24)12-15/h1-9,25H,10-12H2 |
| InChIKey | YHXCIRIYUPFNEO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane?
The IUPAC name of tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane (CID 153323676) is tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane.
What is the SMILES notation for tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane?
The canonical SMILES for tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane is O[Si](C1=CC=CC(F)(F)C1)(C1=CC=CC(F)(F)C1)C1=CC=CC(F)(F)C1.
What is the InChIKey of tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane?
The InChIKey is YHXCIRIYUPFNEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F6OSi/c19-16(20)7-1-4-13(10-16)26(25,14-5-2-8-17(21,22)11-14)15-6-3-9-18(23,24)12-15/h1-9,25H,10-12H2.
What are the key properties of tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane?
tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane has a molecular weight of 390.40 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tris(5,5-difluorocyclohexa-1,3-dien-1-yl)-hydroxysilane is sourced from PubChem (CID 153323676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).