About magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide
magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide (PubChem CID 153323741) has the molecular formula C18H15BrF6MgOSi
and a molecular weight of 493.60 g/mol. Its IUPAC name is magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide.
Molecular Properties
| Compound Name | magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide |
| PubChem CID | 153323741 |
| Molecular Formula | C18H15BrF6MgOSi |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide |
| SMILES | [Br-].[Mg+2].[O-][Si](C1C=CC=CC1(F)F)(C1C=CC=CC1(F)F)C1C=CC=CC1(F)F |
| InChI | InChI=1S/C18H15F6OSi.BrH.Mg/c19-16(20)10-4-1-7-13(16)26(25,14-8-2-5-11-17(14,21)22)15-9-3-6-12-18(15,23)24;;/h1-15H;1H;/q-1;;+2/p-1 |
| InChIKey | SDJBAUIWEOAGMV-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide?
The IUPAC name of magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide (CID 153323741) is magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide.
What is the SMILES notation for magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide?
The canonical SMILES for magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide is [Br-].[Mg+2].[O-][Si](C1C=CC=CC1(F)F)(C1C=CC=CC1(F)F)C1C=CC=CC1(F)F.
What is the InChIKey of magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide?
The InChIKey is SDJBAUIWEOAGMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15F6OSi.BrH.Mg/c19-16(20)10-4-1-7-13(16)26(25,14-8-2-5-11-17(14,21)22)15-9-3-6-12-18(15,23)24;;/h1-15H;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide?
magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide has a molecular weight of 493.60 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;tris(6,6-difluorocyclohexa-2,4-dien-1-yl)-oxidosilane;bromide is sourced from PubChem (CID 153323741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).