About magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide
magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide (PubChem CID 153323745) has the molecular formula C24H27BrMgO7Si
and a molecular weight of 559.77 g/mol. Its IUPAC name is magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide.
Molecular Properties
| Compound Name | magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide |
| PubChem CID | 153323745 |
| Molecular Formula | C24H27BrMgO7Si |
| Molecular Weight | 559.77 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide |
| SMILES | COc1ccc([Si]([O-])(c2ccc(OC)c(OC)c2)c2ccc(OC)c(OC)c2)cc1OC.[Br-].[Mg+2] |
| InChI | InChI=1S/C24H27O7Si.BrH.Mg/c1-26-19-10-7-16(13-22(19)29-4)32(25,17-8-11-20(27-2)23(14-17)30-5)18-9-12-21(28-3)24(15-18)31-6;;/h7-15H,1-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | VDEFHLFCDHISAC-UHFFFAOYSA-M |
| XLogP | -2.31 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 559.77 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide?
The IUPAC name of magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide (CID 153323745) is magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide.
What is the SMILES notation for magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide?
The canonical SMILES for magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide is COc1ccc([Si]([O-])(c2ccc(OC)c(OC)c2)c2ccc(OC)c(OC)c2)cc1OC.[Br-].[Mg+2].
What is the InChIKey of magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide?
The InChIKey is VDEFHLFCDHISAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H27O7Si.BrH.Mg/c1-26-19-10-7-16(13-22(19)29-4)32(25,17-8-11-20(27-2)23(14-17)30-5)18-9-12-21(28-3)24(15-18)31-6;;/h7-15H,1-6H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide?
magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide has a molecular weight of 559.77 g/mol, XLogP of -2.31, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;tris(3,4-dimethoxyphenyl)-oxidosilane;bromide is sourced from PubChem (CID 153323745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).