C15H14F15I — CID 153324225
1-iodo-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclooctane (PubChem CID 153324225) has the molecular formula C15H14F15I and a molecular weight of 606.15 g/mol. Its IUPAC name is 1-iodo-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclooctane.
| Compound Name | 1-iodo-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclooctane |
|---|---|
| PubChem CID | 153324225 |
| Molecular Formula | C15H14F15I |
| Molecular Weight | 606.15 g/mol |
| Exact Mass | 605.99 |
| IUPAC Name | 1-iodo-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)cyclooctane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCCCC1I |
| InChI | InChI=1S/C15H14F15I/c16-9(17,7-5-3-1-2-4-6-8(7)31)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h7-8H,1-6H2 |
| InChIKey | OHFNQMJBRAOQKR-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.15 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|