About 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine
6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine (PubChem CID 153324730) has the molecular formula C13H21NS
and a molecular weight of 223.38 g/mol. Its IUPAC name is 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine |
| PubChem CID | 153324730 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine |
| SMILES | CCC1C=C2CCN(C(C)(C)C)C=C2S1 |
| InChI | InChI=1S/C13H21NS/c1-5-11-8-10-6-7-14(13(2,3)4)9-12(10)15-11/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | SCNBWAXXFQKNNU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine?
The IUPAC name of 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine (CID 153324730) is 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine.
What is the SMILES notation for 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine?
The canonical SMILES for 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine is CCC1C=C2CCN(C(C)(C)C)C=C2S1.
What is the InChIKey of 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine?
The InChIKey is SCNBWAXXFQKNNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NS/c1-5-11-8-10-6-7-14(13(2,3)4)9-12(10)15-11/h8-9,11H,5-7H2,1-4H3.
What are the key properties of 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine?
6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine has a molecular weight of 223.38 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-ethyl-4,5-dihydro-2H-thieno[2,3-c]pyridine is sourced from PubChem (CID 153324730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).