C42H54O4 — CID 153325034
2,3,5,6-tetramethyl-4-[1,2,2-tris(4-hydroxy-2,3,5,6-tetramethylphenyl)ethyl]phenol (PubChem CID 153325034) has the molecular formula C42H54O4 and a molecular weight of 622.89 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-4-[1,2,2-tris(4-hydroxy-2,3,5,6-tetramethylphenyl)ethyl]phenol.
| Compound Name | 2,3,5,6-tetramethyl-4-[1,2,2-tris(4-hydroxy-2,3,5,6-tetramethylphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 153325034 |
| Molecular Formula | C42H54O4 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 2,3,5,6-tetramethyl-4-[1,2,2-tris(4-hydroxy-2,3,5,6-tetramethylphenyl)ethyl]phenol |
| SMILES | Cc1c(C)c(C(c2c(C)c(C)c(O)c(C)c2C)C(c2c(C)c(C)c(O)c(C)c2C)c2c(C)c(C)c(O)c(C)c2C)c(C)c(C)c1O |
| InChI | InChI=1S/C42H54O4/c1-17-25(9)39(43)26(10)18(2)33(17)37(34-19(3)27(11)40(44)28(12)20(34)4)38(35-21(5)29(13)41(45)30(14)22(35)6)36-23(7)31(15)42(46)32(16)24(36)8/h37-38,43-46H,1-16H3 |
| InChIKey | VXBUYRNHECEEPE-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |