About 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine
9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine (PubChem CID 153325264) has the molecular formula C18H12Cl2N4S
and a molecular weight of 387.30 g/mol. Its IUPAC name is 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine.
Molecular Properties
| Compound Name | 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine |
| PubChem CID | 153325264 |
| Molecular Formula | C18H12Cl2N4S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine |
| SMILES | Clc1cc(Cl)cc(Sc2nc3cncnc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H12Cl2N4S/c19-13-6-14(20)8-15(7-13)25-18-23-16-9-21-11-22-17(16)24(18)10-12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | IZJSTJTUGAEVEY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine?
The IUPAC name of 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine (CID 153325264) is 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine.
What is the SMILES notation for 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine?
The canonical SMILES for 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine is Clc1cc(Cl)cc(Sc2nc3cncnc3n2Cc2ccccc2)c1.
What is the InChIKey of 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine?
The InChIKey is IZJSTJTUGAEVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N4S/c19-13-6-14(20)8-15(7-13)25-18-23-16-9-21-11-22-17(16)24(18)10-12-4-2-1-3-5-12/h1-9,11H,10H2.
What are the key properties of 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine?
9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine has a molecular weight of 387.30 g/mol, XLogP of 5.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-8-(3,5-dichlorophenyl)sulfanylpurine is sourced from PubChem (CID 153325264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).