About 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine
8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine (PubChem CID 153325277) has the molecular formula C19H14Cl2N4S
and a molecular weight of 401.32 g/mol. Its IUPAC name is 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine.
Molecular Properties
| Compound Name | 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine |
| PubChem CID | 153325277 |
| Molecular Formula | C19H14Cl2N4S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine |
| SMILES | Clc1cc(Cl)cc(Sc2nc3cncnc3n2CCc2ccccc2)c1 |
| InChI | InChI=1S/C19H14Cl2N4S/c20-14-8-15(21)10-16(9-14)26-19-24-17-11-22-12-23-18(17)25(19)7-6-13-4-2-1-3-5-13/h1-5,8-12H,6-7H2 |
| InChIKey | QOZITAQGGOVPRB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine?
The IUPAC name of 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine (CID 153325277) is 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine.
What is the SMILES notation for 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine?
The canonical SMILES for 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine is Clc1cc(Cl)cc(Sc2nc3cncnc3n2CCc2ccccc2)c1.
What is the InChIKey of 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine?
The InChIKey is QOZITAQGGOVPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N4S/c20-14-8-15(21)10-16(9-14)26-19-24-17-11-22-12-23-18(17)25(19)7-6-13-4-2-1-3-5-13/h1-5,8-12H,6-7H2.
What are the key properties of 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine?
8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine has a molecular weight of 401.32 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,5-dichlorophenyl)sulfanyl-9-(2-phenylethyl)purine is sourced from PubChem (CID 153325277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).