C18H36B2O4 — CID 153325303
4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]-1,3,2-dioxaborinane (PubChem CID 153325303) has the molecular formula C18H36B2O4 and a molecular weight of 338.11 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]-1,3,2-dioxaborinane.
| Compound Name | 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 153325303 |
| Molecular Formula | C18H36B2O4 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]-1,3,2-dioxaborinane |
| SMILES | CC1CC(C)(C)OB(C(C)CC(C)(C)B2OC(C)CC(C)(C)O2)O1 |
| InChI | InChI=1S/C18H36B2O4/c1-13(19-21-14(2)11-17(6,7)23-19)10-16(4,5)20-22-15(3)12-18(8,9)24-20/h13-15H,10-12H2,1-9H3 |
| InChIKey | FWWUNUBSPMGQSY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|