C30H58N4O6 — CID 153325403
2-[(2S,5S,8S,11S)-7,10-bis(carboxymethyl)-2,5,8,11-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 153325403) has the molecular formula C30H58N4O6 and a molecular weight of 570.82 g/mol. Its IUPAC name is 2-[(2S,5S,8S,11S)-7,10-bis(carboxymethyl)-2,5,8,11-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[(2S,5S,8S,11S)-7,10-bis(carboxymethyl)-2,5,8,11-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 153325403 |
| Molecular Formula | C30H58N4O6 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.44 |
| IUPAC Name | 2-[(2S,5S,8S,11S)-7,10-bis(carboxymethyl)-2,5,8,11-tetrakis(2-methylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)C[C@H]1CN(CC(=O)O)[C@@H](CC(C)C)CN(CC(=O)O)[C@@H](CC(C)C)CN(CC(=O)O)[C@@H](CC(C)C)CN1 |
| InChI | InChI=1S/C30H58N4O6/c1-20(2)9-24-14-32(17-28(35)36)26(11-22(5)6)16-34(19-30(39)40)27(12-23(7)8)15-33(18-29(37)38)25(13-31-24)10-21(3)4/h20-27,31H,9-19H2,1-8H3,(H,35,36)(H,37,38)(H,39,40)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | PPUIDLGKALPHMX-FWEHEUNISA-N |
| XLogP | 3.41 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |