C18H20Cl2N5O7P — CID 153325444
[(2R,3S,4R,5R)-5-[2-chloro-6-[(2-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 153325444) has the molecular formula C18H20Cl2N5O7P and a molecular weight of 520.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-6-[(2-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-6-[(2-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 153325444 |
| Molecular Formula | C18H20Cl2N5O7P |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-6-[(2-chlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20Cl2N5O7P/c19-10-4-2-1-3-9(10)5-21-15-12-16(24-18(20)23-15)25(7-22-12)17-14(27)13(26)11(32-17)6-31-8-33(28,29)30/h1-4,7,11,13-14,17,26-27H,5-6,8H2,(H,21,23,24)(H2,28,29,30)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | PUAQXAWGKJGTPV-LSCFUAHRSA-N |
| XLogP | 1.52 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|