cobalt;phenoxyphosphinic acid

C12H14CoO6P2 — CID 153325844

IUPACcobalt;phenoxyphosphinic acid
SMILESO=[PH](O)Oc1ccccc1.O=[PH](O)Oc1ccccc1.[Co]
InChIInChI=1S/2C6H7O3P.Co/c2*7-10(8)9-6-4-2-1-3-5-6;/h2*1-5,10H,(H,7,8);
InChIKeyXYCQEVJGSBMLJA-UHFFFAOYSA-N
MW375.12 g/mol
LogP2.89
Rot. Bonds4

About cobalt;phenoxyphosphinic acid

cobalt;phenoxyphosphinic acid (PubChem CID 153325844) has the molecular formula C12H14CoO6P2 and a molecular weight of 375.12 g/mol. Its IUPAC name is cobalt;phenoxyphosphinic acid.

Molecular Properties

Compound Namecobalt;phenoxyphosphinic acid
PubChem CID153325844
Molecular FormulaC12H14CoO6P2
Molecular Weight375.12 g/mol
Exact Mass374.96
IUPAC Namecobalt;phenoxyphosphinic acid
SMILESO=[PH](O)Oc1ccccc1.O=[PH](O)Oc1ccccc1.[Co]
InChIInChI=1S/2C6H7O3P.Co/c2*7-10(8)9-6-4-2-1-3-5-6;/h2*1-5,10H,(H,7,8);
InChIKeyXYCQEVJGSBMLJA-UHFFFAOYSA-N
XLogP2.89
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500375.12
LogP ≤ 52.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cobalt;phenoxyphosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cobalt;phenoxyphosphinic acid?
The IUPAC name of cobalt;phenoxyphosphinic acid (CID 153325844) is cobalt;phenoxyphosphinic acid.
What is the SMILES notation for cobalt;phenoxyphosphinic acid?
The canonical SMILES for cobalt;phenoxyphosphinic acid is O=[PH](O)Oc1ccccc1.O=[PH](O)Oc1ccccc1.[Co].
What is the InChIKey of cobalt;phenoxyphosphinic acid?
The InChIKey is XYCQEVJGSBMLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7O3P.Co/c2*7-10(8)9-6-4-2-1-3-5-6;/h2*1-5,10H,(H,7,8);.
What are the key properties of cobalt;phenoxyphosphinic acid?
cobalt;phenoxyphosphinic acid has a molecular weight of 375.12 g/mol, XLogP of 2.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;phenoxyphosphinic acid is sourced from PubChem (CID 153325844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).