About [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate
[3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate (PubChem CID 153325899) has the molecular formula C12H11N5O6S
and a molecular weight of 353.32 g/mol. Its IUPAC name is [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate.
Molecular Properties
| Compound Name | [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
| PubChem CID | 153325899 |
| Molecular Formula | C12H11N5O6S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate |
| SMILES | O=C1N2CC=CC(C2)N1OS(=O)(=O)On1ccc(-c2ncco2)n1 |
| InChI | InChI=1S/C12H11N5O6S/c18-12-15-5-1-2-9(8-15)17(12)23-24(19,20)22-16-6-3-10(14-16)11-13-4-7-21-11/h1-4,6-7,9H,5,8H2 |
| InChIKey | JNPVQDQAQWUIAU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 120.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate?
The IUPAC name of [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate (CID 153325899) is [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate.
What is the SMILES notation for [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate?
The canonical SMILES for [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate is O=C1N2CC=CC(C2)N1OS(=O)(=O)On1ccc(-c2ncco2)n1.
What is the InChIKey of [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate?
The InChIKey is JNPVQDQAQWUIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O6S/c18-12-15-5-1-2-9(8-15)17(12)23-24(19,20)22-16-6-3-10(14-16)11-13-4-7-21-11/h1-4,6-7,9H,5,8H2.
What are the key properties of [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate?
[3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate has a molecular weight of 353.32 g/mol, XLogP of -0.18, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-oxazol-2-yl)pyrazol-1-yl] (7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl) sulfate is sourced from PubChem (CID 153325899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).