C13H27NO3S — CID 153326043
3,3-dimethyl-1-[(3-methylcyclohexyl)amino]butane-1-sulfonic acid (PubChem CID 153326043) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(3-methylcyclohexyl)amino]butane-1-sulfonic acid.
| Compound Name | 3,3-dimethyl-1-[(3-methylcyclohexyl)amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 153326043 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3,3-dimethyl-1-[(3-methylcyclohexyl)amino]butane-1-sulfonic acid |
| SMILES | CC1CCCC(NC(CC(C)(C)C)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H27NO3S/c1-10-6-5-7-11(8-10)14-12(18(15,16)17)9-13(2,3)4/h10-12,14H,5-9H2,1-4H3,(H,15,16,17) |
| InChIKey | TXKMDZHRLWCBCW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|